| Identification | |
| Name: | Acetone-d6 |
| Synonyms: | Acetone-d6 + 0.05% v/v TMS; ACETONE-D |
| CAS: | 666-52-4 |
| EINECS: | 211-563-9 |
| Molecular Formula: | [2H]6C3O |
| Molecular Weight: | 64.11 |
| InChI: | InChI=1/C3H6O/c1-3(2)4/h1-2H3/i1D3,2D3 |
| Molecular Structure: | ![([2H]6C3O) Acetone-d6 + 0.05% v/v TMS; ACETONE-D](https://img.guidechem.com/casimg/666-52-4.gif) |
| Properties | |
| Transport: | UN 1090 3/PG 2 |
| Density: | 0.79 |
| Stability: | Stable. Highly flammable. Readily forms explosive mixtures with air. Note low flashpoint and wide explosion limits. Incompatible with bases, oxidising agents, strong acids, reducing agents. Protect from moisture. |
| Refractive index: | n20/D 1.355(lit.) |
| Solubility: | Miscible with benzene Miscible with water, alcohol, dimethylformamide, ether Miscible with chloroform, most oils |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless volatile liquid |
| Safety Data | |
| Hazard Symbols |
F:Highlyflammable
Xi:Irritant
|
 |
|
