| Identification | |
| Name: | BIO |
| Synonyms: | (3Z)-6-Br;2H-Indol- |
| CAS: | 667463-62-9 |
| Molecular Formula: | C16H10BrN3O2 |
| Molecular Weight: | 356.178 |
| InChI: | InChI=1/C16H10BrN3O2/c17-8-5-6-9-12(7-8)19-16(21)13(9)15-14(20-22)10-3-1-2-4-11(10)18-15/h1-7,18,22H,(H,19,21)/b15-13-,20-14+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 289°C |
| Boiling Point: | 554.3°C at 760 mmHg |
| Density: | 1.8g/cm3 |
| Refractive index: | 1.801 |
| Biological Activity: | Potent and selective, ATP-competitive glycogen synthase kinase-3 (GSK-3) inhibitor (IC 50 values are 5, 83, 300, 320 and > 10 000 nM at GSK-3, CDK5/p25, CDK2/cyclin A, CDK1/cyclin B and other common kinases respectively). Maintains self-renewal and pluripotency in embryonic stem cells via activation of the Wnt signaling pathway in vitro . |
| Flash Point: | 289°C |
| Storage Temperature: | 2-8°C |
| Color: | dark red |
| Safety Data | |
 |
|
