| Identification | |
| Name: | Butanamide,3-oxo-N-[3-(trifluoromethyl)phenyl]- |
| Synonyms: | m-Acetoacetotoluidide,a,a,a-trifluoro- (7CI,8CI); 3-Oxo-N-[3-(trifluoromethyl)phenyl]butanamide;3'-(Trifluoromethyl)acetoacetanilide; Acetoacetyl-3-(trifluoromethyl)anilide |
| CAS: | 6699-27-0 |
| Molecular Formula: | C11H10 F3 N O2 |
| Molecular Weight: | 252.3093 |
| InChI: | InChI=1S/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H |
| Molecular Structure: | ![(C11H10F3NO2) m-Acetoacetotoluidide,a,a,a-trifluoro- (7CI,8CI); 3-Oxo-N-[3-(trifluoromethyl)phenyl]butanamide;3'-(...](https://img1.guidechem.com/chem/e/dict/69/6699-27-0.jpg) |
| Properties | |
| Melting Point: | 179 deg C |
| Flash Point: | 228.6°C |
| Boiling Point: | 495°Cat760mmHg |
| Density: | 1.286g/cm3 |
| Solubility: | Sol in benzene, toluene, xylene, and ether; slightly sol in alcohol Very soluble in chloroform Solubility in aqueous caffeine is higher than in water; also, native DNA has a solubilizing effect In water, 1.62X10-3 mg/L at 25 deg C |
| Flash Point: | 228.6°C |
| Color: | PALE YELLOW MONOCLINIC NEEDLES FROM BENZENE & METHANOL Yellowish plates, needles from benzene + methanol; crystals may be monoclinic or orthorhombic. Yellowish plates (from benzene and ligroin) |
| Safety Data | |
 |
|
