| Identification | ||
| Name: | Nitrofurantoin | |
| Synonyms: | Furadonin;Uerineks;Sodium nitrofurantoin;Berkfuran;Macrodantina;1-[[(5-Nitro-2-furanyl)methylene]amino]-2,4-imidazolidinedione;Urantoin;2,4-Imidazolidinedione,1-[[(5-nitro-2- furanyl)methylene]amino]-;1-[(5-nitro-2-furyl)methylideneamino]imidazolidine-2,4-dione;Urolisa;Furatoin;NSC-2107;Furadantin;N-Toin;1-(5-Nitro-2-furfurylidenamino)hydantoin;54-87-5;5-Nitrofurantoin;Furadonine;2,4-Imidazolidinedione, 1-[[ (5-nitro-2-furanyl)methylene]amino]-;Macrofurin;Trantoin;Urodin;Furina;Hydantoin, 1-(5-nitro-furfurylideneamino)-;Macpac;Hydantoin, 1-((5-nitrofurfurylidene)amino)-;Zoofurin;PiyEloseptyl;Ceduran;Urofuran;Welfurin;N-(5-Nitrofurfurylidene)-1-aminohydantoin;ND-7248;Furadontin;Furadantin Retard;Urolong;Furadantin (TN);Cistofuran;Furadantine mc;Nifurantin;Siraliden;Urofurin;Nitrofuradantin;Alfuran;Furophen T;Parfuran;Macrobid;Ro-Antoin;Nitoin;Benkfuran;2,4-Imidazolidenedione, 1-(((5-nitro-2-furanyl)methylene)amino)-;Chemiofuran; | |
| CAS: | 67-20-9 | |
| EINECS: | 200-646-5 | |
| Molecular Formula: | C8H6N4O5 | |
| Molecular Weight: | 238.16 | |
| InChI: | InChI=1/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3+ | |
| Molecular Structure: | ![(C8H6N4O5) Furadonin;Uerineks;Sodium nitrofurantoin;Berkfuran;Macrodantina;1-[[(5-Nitro-2-furanyl)methylene]ami...](https://img.guidechem.com/casimg/67-20-9.gif) |
|
| Properties | ||
| Transport: | 2811 | |
| Flash Point: | 43 | |
| Density: | 0.915 g/cm3 (20 C) | |
| Stability: | Stability Stable, but light-sensitive. Combustible. Incompatible with strong oxidizing agents, strong alkalies, strong acids. Decomposes upon contact with most metals other than stainless steel and aluminium. | |
| Refractive index: | 1.52 (20 C) | |
| Water Solubility: | <0.01 g/100 mL at 19 ºC | |
| Solubility: | <0.01 g/100 mL at 19 oC | |
| Appearance: | lemon yellow crystalline powder | |
| Specification: | lemon yellow crystalline powder usageEng:A nitrofuran antibiotic with low resistance potential that is rapidly metabolized by mammals. Active against both Gram-positive and Gram-negative bacteria. Nitrofurantoin is also a prooxidant that is cytotoxic due to the generation of intracellular H2O2. Safety Statements:22-36/37-45 22:Do not breathe dust 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) | |
| Packinggroup: | III | |
| HS Code: | 29349990 | |
| Flash Point: | 43 | |
| Color: | yellow | |
| Usage: | Ingredient in expectorants, tonic to treat pellagra, a pain relief formula, and and expectorant. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
