| Identification | |
| Name: | Homocysteine, S-ethyl- |
| CAS: | 67-21-0 |
| EINECS: | 200-647-0 |
| Molecular Formula: | C6H13 N O2 S |
| Molecular Weight: | 163.23 |
| InChI: | InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 286.5°C |
| Boiling Point: | 550.1°C at 760 mmHg |
| Density: | 1.164 |
| Solubility: | Solubility in acetone at 25 deg C: 2.4 g/100mL; in alcohol: 0.1g/100 mL. Practically insoluble in water but will dissolve slowly as hydrolysis takes place. In water, 6.89X10+4 mg/L at 25 deg C (est) |
| Specification: | Off-White Solid Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 286.5°C |
| Storage Temperature: | −20°C |
| Color: | White needles Crystals |
| Safety Data | |
 |
|
