| Identification | |
| Name: | Atumin |
| Synonyms: | [1,1'-Bicyclohexyl]-1-carboxylicacid, 2-(diethylamino)ethyl ester, hydrochloride (9CI);[Bicyclohexyl]-1-carboxylic acid, 2-(diethylamino)ethyl ester hydrochloride(6CI,7CI,8CI); Atumin; Benacol; Bentomine; Bentyl hydrochloride; Di-Syntramine;Dicyclomine hydrochloride; Dicycloverin hydrochloride; Diocyl hydrochloride;Dyspas; Mamiesan; Merbentyl; Procyclomin; Wyovin hydrochloride; b-Diethylaminoethyl1-cyclohexylcyclohexanecarboxylate hydrochloride |
| CAS: | 67-92-5 |
| EINECS: | 200-671-1 |
| Molecular Formula: | C19H35 N O2 . Cl H |
| Molecular Weight: | 345.95 |
| InChI: | InChI=1/C19H35NO2.ClH/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17;/h17H,3-16H2,1-2H3;1H |
| Molecular Structure: | ![(C19H35NO2.ClH) [1,1'-Bicyclohexyl]-1-carboxylicacid, 2-(diethylamino)ethyl ester, hydrochloride (9CI);[Bicyclohexyl...](https://img1.guidechem.com/structure/image/67-92-5.gif) |
| Properties | |
| Flash Point: | 116.5°C |
| Boiling Point: | 399.8°C at 760 mmHg |
| Specification: |
The extinguishing agent of Atumin (CAS No.67-92-5) are dry powder, foam, sand, carbon dioxide, water mist. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 116.5°C |
| Color: | off-white |
| Usage: | Used as a gastrointestinal antispasmodic antacid |
| Safety Data | |
 |
|
