| Identification |
| Name: | Metazachlor |
| Synonyms: | 2-chloro-N-(2,6-dimethylphenyl)-N-(1H-pyrazol-1-ylmethyl)acetamide; 2-Chloro-N-(pyrazol-1-ylmethyl)acet-2,6-xylidide |
| CAS: | 67129-08-2 |
| EINECS: | 266-583-0 |
| Molecular Formula: | C14H16ClN3O |
| Molecular Weight: | 277.75 |
| InChI: | InChI=1/C14H16ClN3O/c1-11-5-3-6-12(2)14(11)18(13(19)9-15)10-17-8-4-7-16-17/h3-8H,9-10H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1648 3/PG 2 |
| Density: | 1.19 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.586 |
| Solubility: | Insoluble |
| Storage Temperature: | APPROX 4°C |
| Usage: | Herbicide for weed control in the cropping of papaver somniferum. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
