| Identification | |
| Name: | L-Homoserine |
| Synonyms: | Butyric acid, 2-amino-4-hydroxy-, L- (8CI);Butanoic acid, 2-amino-4-hydroxy-, (S)-;2-amino-4-hydroxy-butanoic acid;2-Amino-4-hydroxybutyric acid;Butyric acid, 2-amino-4-hydroxy-, L-;(2S)-2-amino-4-hydroxy-butanoic acid;Homoserine (VAN);H-Homoserine;H-Hse-OH;L-Homo-serine;H-HoSer-OH; |
| CAS: | 672-15-1 |
| EINECS: | 211-590-6 |
| Molecular Formula: | C4H9NO3 |
| Molecular Weight: | 119.12 |
| InChI: | InChI=1/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -8.5 o (C=2, H2O 22 oC) |
| Appearance: | White crystalline powder. |
| HS Code: | 29225000 |
| Storage Temperature: | Store at RT. |
| Usage: | An intermediate in the biosynthesis of methionine, threonine and isoleucine. |
| Safety Data | |
 |
|
