| Identification | |
| Name: | Benzenemethanamine,3-(4-methyl-1-piperazinyl)- |
| Synonyms: | 1-[3-(4-Methylpiperazin-1-yl)phenyl]methanamine;3-(4-Methylpiperazin-1-yl)benzylamine;[3-(4-Methylpiperazin-1-yl)phenyl]methanamine; |
| CAS: | 672325-37-0 |
| Molecular Formula: | C12H19N3 |
| Molecular Weight: | 205.3 |
| InChI: | InChI=1/C12H19N3/c1-14-5-7-15(8-6-14)12-4-2-3-11(9-12)10-13/h2-4,9H,5-8,10,13H2,1H3 |
| Molecular Structure: | ![(C12H19N3) 1-[3-(4-Methylpiperazin-1-yl)phenyl]methanamine;3-(4-Methylpiperazin-1-yl)benzylamine;[3-(4-Methylpi...](https://img.guidechem.com/casimg/672325-37-0.gif) |
| Properties | |
| Transport: | 3261 |
| Flash Point: | 163.8°C |
| Boiling Point: | 351.2°C at 760 mmHg |
| Density: | 1.065g/cm3 |
| Refractive index: | 1.569 |
| Specification: |
1-[3-(4-Methylpiperazin-1-yl)phenyl]methanamine , its cas register number is 672325-37-0. It also can be called benzenemethanamine, 3-(4-methyl-1-piperazinyl)- ; [3-(4-Methylpiperazin-1-yl)phenyl]methylamine; 3-(4-Methyl-1-Piperazinyl)benzenemethanamine ; 3-(4-Methylpiperazin-1-yl)benzylamine . 1-[3-(4-Methylpiperazin-1-yl)phenyl]methanamine (CAS NO.672325-37-0) is irritating to eyes, respiratory system and skin. And it's harmful if swallowed. |
| Flash Point: | 163.8°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
