| Identification | |
| Name: | diketene |
| Synonyms: | diketen; Ketenedimer,99%; Ketene Dimer; DK; Acetyl ketene; 4-Methylene-2-oxetanone; But-3-en-3-olide |
| CAS: | 674-82-8 |
| EINECS: | 211-617-1 |
| Molecular Formula: | C4H4O2 |
| Molecular Weight: | 84.07336 |
| InChI: | InChI=1S/C4H4O2/c1-3-2-4(5)6-3/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2521 |
| Flash Point: | 34? |
| Density: | 1.1 |
| Stability: | Readily polymerizes on standing. |
| Refractive index: | 1.439 |
| Water Solubility: | react with water |
| Solubility: | react with water |
| Appearance: | COLOURLESS LIQUID |
| Specification: | Safety Statements:3-36/37-33-24/25-23-16 3:Keep in a cool place 36/37:Wear suitable protective clothing and gloves 33:Take precautionary measures against static discharges 24/25:Avoid contact with skin and eyes 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | I |
| Flash Point: | 34? |
| Color: | Light colored liquid |
| Usage: | Chemical intermediate for acetoacetic esters & acetoacetanilides, n,n-dialkylacetoacetamides, dyes, pharmaceuticals, for pigments & toners, food preservatives, insecticides, dicrotophos, & the fungicide, dehydroacetic acid. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
