| Identification |
| Name: | Boronicacid, B-(3,5-dichlorophenyl)- |
| Synonyms: | Boronicacid, (3,5-dichlorophenyl)- (9CI);(3,5-Dichlorophenyl)boronic acid;(3,5-Dichlorophenyl)dihydroxyborane;3,5-Dichlorobenzeneboronic acid; |
| CAS: | 67492-50-6 |
| Molecular Formula: | C6H5BCl2O2 |
| Molecular Weight: | 190.82 |
| InChI: | InChI=1/C6H5BCl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 166.5 oC |
| Boiling Point: | 351.7 oC at 760 mmHg |
| Density: | 1.47 g/cm3 |
| Stability: | Far from oxide. |
| Refractive index: | 1.577? |
| Solubility: | Undetermined |
| Appearance: | white to off-white powder |
| Flash Point: | 166.5 oC |
| Storage Temperature: | Stored in sealed container, and put them in a cool, dry place. Storage place must be away from oxidant. |
| Color: | White powder |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
