| Identification | |
| Name: | 4-Hydroxy-6-methyl-2-pyrone |
| Synonyms: | 2H-Pyran-2-one,4-hydroxy-6-methyl-;Sorbicacid, 3,5-dihydroxy-, d-lactone (6CI,7CI);Triacetic acid lactone;4-Hydroxy-6-methyl-2H-pyran-2-one;4-Hydroxy-6-methyl-a-pyrone;4-Hydroxy-6-methylpyran-2-one;6-Methyl-4-hydroxy-2-pyrone;NSC 34625; |
| CAS: | 675-10-5 |
| EINECS: | 211-619-2 |
| Molecular Formula: | C6H6O3 |
| Molecular Weight: | 126.11 |
| InChI: | InChI=1/C6H6O3/c1-4-2-5(7)3-6(8)9-4/h2-3,7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.9 oC |
| Boiling Point: | 285.9 oC at 760 mmHg |
| Density: | 1.348 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.56 |
| Solubility: | 8.60 g/L (20 oC) in water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?Triacetic acid lactone (CAS NO.675-10-5), its Synonyms are 4-Hydroxy-6-methyl-2H-pyran-2-one ; 6-Methyl-4-hydroxypyron-(2) ; 2H-Pyran-2-one, 4-hydroxy-6-methyl- ; 4-Hydroxy-6-methyl-2-pyrone ; 4-Hydroxy-6-methylpyran-4-one . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29322980 |
| Flash Point: | 127.9 oC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
