| Identification | |
| Name: | 3-allyloxypropane-1,2-diol; 2-(2-hydroxyethoxy)ethanol; 2-(2-hydroxyethylsulfanyl)ethanol |
| Synonyms: | AC1O5BMY;3-(2-Propenyloxy)-1,2-propanediol, polymer with 2,2'-oxybisethanol and 2,2'-thiobisethanol;1,2-Propanediol, 3-(2-propen-1-yloxy)-, polymer with 2,2'-oxybis(ethanol) and 2,2'-thiobis(ethanol);1,2-Propanediol, 3-(2-propenyloxy)-, polymer with 2,2'-oxybis(ethanol) and 2,2'-thiobis(ethanol);2-(2-hydroxyethoxy)ethanol; 2-(2-hydroxyethylsulfanyl)ethanol; 3-prop-2-enoxypropane-1,2-diol;67674-61-7 |
| CAS: | 67674-61-7 |
| Molecular Formula: | C14H32O8S |
| Molecular Weight: | 360.4641 |
| InChI: | InChI=1/C6H12O3.C4H10O3.C4H10O2S/c1-2-3-9-5-6(8)4-7;2*5-1-3-7-4-2-6/h2,6-8H,1,3-5H2;2*5-6H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 107°C |
| Boiling Point: | 234.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 107°C |
| Safety Data | |
 |
|
