| Identification | |
| Name: | Propanedioic acid,2-diazo-, 1,3-dimethyl ester |
| Synonyms: | Malonicacid, diazo-, dimethyl ester (7CI,8CI); Propanedioic acid, diazo-, dimethylester (9CI); Bis(methoxycarbonyl)diazomethane; Diazodimethylmalonate;Diazomalonic acid dimethyl ester; Diazomalonic acid methyl ester;Diazopropanedioic acid dimethyl ester; Dicarbomethoxydiazomethane; Dimethyl2-diazomalonate; Dimethyl diazomalonate; Methyl diazomalonate; NSC 138651 |
| CAS: | 6773-29-1 |
| Molecular Formula: | C5H6 N2 O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H6N2O4/c1-10-4(8)3(7-6)5(9)11-2/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The cas register number of Dimethyl 2-diazomalonate is 6773-29-1. It also can be called as 2-Diazopropanedioic acid 1,3-dimethyl ester and the IUPAC Name about this chemical is 2-diazonio-1,3-dimethoxy-3-oxoprop-1-en-1-olate. Physical properties about Dimethyl 2-diazomalonate are: (1)#H bond acceptors: 6; (2)#H bond donors: 1; (3)#Freely Rotating Bonds: 5; (4)XLogP3-AA: 1.7; (5)H-Bond Acceptor: 5; (6)Rotatable Bond Count: 3; (7)Exact Mass: 158.032757; (8)MonoIsotopic Mass: 158.032757; (9)Topological Polar Surface Area: 86.7; (10)Heavy Atom Count: 11; (11)Complexity: 219; (12)Undefined Bond StereoCenter Count: 1; (13)Covalently-Bonded Unit Count 1; (14)Polar Surface Area: 83.91Å2. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
