| Identification | |
| Name: | Prochloraz |
| Synonyms: | N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide; N-propyl-N-[2-(2,4,6-trichlorophenoxy) ethyl]-1H-imidazole-1-carboxamide; N-Propyl-N-(2,4,6-trichlorophenoxy)ethyl-imidazole-1-carboxamide |
| CAS: | 67747-09-5 |
| EINECS: | 266-994-5 |
| Molecular Formula: | C15H16Cl3N3O2 |
| Molecular Weight: | 376.67 |
| InChI: | InChI=1/C15H16Cl3N3O2/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18/h3,5,8-10H,2,4,6-7H2,1H3 |
| Molecular Structure: | ![(C15H16Cl3N3O2) N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide; N-propyl-N-[2-(2,4,6-trichlorop...](https://img.guidechem.com/casimg/67747-09-5.gif) |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.37 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.596 |
| Solubility: | Insoluble |
| Appearance: | colorless solid |
| Packinggroup: | III |
| Usage: | Used to kill fungus. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
