Identification |
Name: | tridecyl dihydrogen phosphate, compound with N,N-dimethyl-1-octadecylamine (1:1) |
Synonyms: | 1-Tridecanol, dihydrogen phosphate, compd. with N,N-dimethyl-1-octadecanamine (1:1);Tridecyl dihydrogen phosphate, compound with N,N-dimethyl-1-octadecylamine (1:1);tridecyl dihydrogen phosphate - N,N-dimethyloctadecan-1-amine (1:1) |
CAS: | 67846-17-7 |
EINECS: | 267-361-6 |
Molecular Formula: | C33H72NO4P |
Molecular Weight: | 577.9028 |
InChI: | InChI=1/C20H43N.C13H29O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-17-18(14,15)16/h4-20H2,1-3H3;2-13H2,1H3,(H2,14,15,16) |
Molecular Structure: |
|
Properties |
Flash Point: | 153.8°C |
Boiling Point: | 348.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 153.8°C |
Safety Data |
|
|