| Identification |
| Name: | N-[5-[bis(2-cyanoethyl)amino]-2-[(2-bromo-4,6-dinitrophenyl)azo]-4-methoxyphenyl]acetamide |
| Synonyms: | N-[5-[bis(2-cyanoethyl)amino]-2-[(2-bromo-4,6-dinitrophenyl)azo]-4-methoxyphenyl]acetamide;Acetamide, N-(5-(bis(2-cyanoethyl)amino)-2-((2-bromo-4,6-dinitrophenyl)azo)-4-methoxyphenyl)-;Acetamide, N-(5-(bis(2-cyanoethyl)amino)-2-(2-(2-bromo-4,6-dinitrophenyl)diazenyl)-4-methoxyphenyl)-;Einecs 267-518-9;p-Acetanisidide, 5'-(bis(2-cyanoethyl)amino)-2'-((2-bromo-4,6-dinitrophenyl)azo)- |
| CAS: | 67875-05-2 |
| EINECS: | 267-518-9 |
| Molecular Formula: | C21H19BrN8O6 |
| Molecular Weight: | 559.32956 |
| InChI: | InChI=1/C21H19BrN8O6/c1-13(31)25-16-11-18(28(7-3-5-23)8-4-6-24)20(36-2)12-17(16)26-27-21-15(22)9-14(29(32)33)10-19(21)30(34)35/h9-12H,3-4,7-8H2,1-2H3,(H,25,31)/b27-26+ |
| Molecular Structure: |
![(C21H19BrN8O6) N-[5-[bis(2-cyanoethyl)amino]-2-[(2-bromo-4,6-dinitrophenyl)azo]-4-methoxyphenyl]acetamide;Acetamide...](https://img.guidechem.com/structure/67875-05-2.gif) |
| Properties |
| Flash Point: | 465.8°C |
| Boiling Point: | 846.7°C at 760 mmHg |
| Density: | 1.56g/cm3 |
| Refractive index: | 1.661 |
| Flash Point: | 465.8°C |
| Safety Data |
| |
 |