Identification |
Name: | decyl dihydrogen phosphate, compound with 2-(dibutylamino)ethanol |
Synonyms: | Phosphoric acid, monodecyl ester, compd. with 2-(dibutylamino)ethanol (1:?);Phosphoric acid, monodecyl ester, dibutylethanolamine salt;Decyl dihydrogen phosphate, compound with 2-(dibutylamino)ethanol;Phosphoric acid, monodecyl ester, compd. with 2-(dibutylamino)ethanol;decyl dihydrogen phosphate - 2-(dibutylamino)ethanol (1:1) |
CAS: | 67969-86-2 |
EINECS: | 267-988-5 |
Molecular Formula: | C20H46NO5P |
Molecular Weight: | 411.5567 |
InChI: | InChI=1/C10H23NO.C10H23O4P/c1-3-5-7-11(9-10-12)8-6-4-2;1-2-3-4-5-6-7-8-9-10-14-15(11,12)13/h12H,3-10H2,1-2H3;2-10H2,1H3,(H2,11,12,13) |
Molecular Structure: |
 |
Properties |
Flash Point: | 169.8°C |
Boiling Point: | 357.2°C at 760 mmHg |
Flash Point: | 169.8°C |
Safety Data |
|
 |