| Identification | |
| Name: | Hypoxanthine |
| Synonyms: | Sarcine;9H-Purin-6-ol (VAN);Hypoxanthine enol;3,7-dihydropurin-6-one;3,5-dihydropurin-6-one;Hypoxanthine (VAN) (8CI);3H-Purin-6-ol;9H-Purin-6(1H)-one;1,9-Dihydro-purin-6-one;Sarkine;Hyp;Purin-6(3H)-one;25991-09-7;HX;Sarkin;Purine-6-ol;Purin-6(1H)-one;6H-Purin-6-one, 1,7-dihydro-;6(1H)-purinone;1,7-Dihydro-6H-purin-6-one;6H-Purin-6-one,1,7-dihydro-;39464-15-8;Purin-6-ol;9H-purin-6-ol;6-Hydroxypurine;6-Hydroxypurine (Hypoxanthine); |
| CAS: | 68-94-0 |
| EINECS: | 200-697-3 |
| Molecular Formula: | C5H4N4O |
| Molecular Weight: | 136.11 |
| InChI: | InChI=1/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.89 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.902 |
| Water Solubility: | practically insoluble |
| Solubility: | Insoluble |
| Appearance: | white powder |
| Usage: | An intermediate in the metabolism of animal purines. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
