| Identification | |
| Name: | 2,5-dichlorobenzenediazonium chloride, compound with zinc chloride |
| Synonyms: | Benzenediazonium, 2,5-dichloro-, chloride, compd. with zinc chloride (ZnCl2) (1:1:?);2,5-Dichlorobenzenediazonium, chloride, compound with zinc chlorie;2,5-Dichlorobenzenediazonium chloride, compound with zinc chloride;Benzenediazonium, 2,5-dichloro-, chloride, compd. with zinc chloride (ZnCl2);2,5-dichlorobenzenediazonium zinc chloride (1:1:3) |
| CAS: | 68025-26-3 |
| EINECS: | 268-184-7 |
| Molecular Formula: | C6H3Cl5N2Zn |
| Molecular Weight: | 345.7754 |
| InChI: | InChI=1/C6H3Cl2N2.3ClH.Zn/c7-4-1-2-5(8)6(3-4)10-9;;;;/h1-3H;3*1H;/q+1;;;;+2/p-3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data | |
 |
|
