| Identification |
| Name: | Urea, polymer with formaldehyde, butylated isobutylated |
| Synonyms: | Urea, polymer with formaldehyde, butylated isobutylated;Butylated and isobutylated urea formaldehyde resin;Urea, formaldehyde polymer, butylated, isobutylated;Urea, formaldehyde resin, butylated, ad isobutylated |
| CAS: | 68071-44-3 |
| Molecular Formula: | C2H6N2O2 |
| Molecular Weight: | 90.08124 |
| InChI: | InChI=1S/CH4N2O.CH2O/c2-1(3)4;1-2/h(H4,2,3,4);1H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 72.7°C |
| Boiling Point: | 196.6°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Solubility in water = 0.28-0.31% |
| Flash Point: | 72.7°C |
| Color: | Amorphous powder |
| Safety Data |
| |
 |
