| Identification |
| Name: | Propanol, (1-methyl-1,2-ethanediyl)bis(oxy)bis-, polymer with 1,1-methylenebisisocyanatobenzene and oxybispropanol |
| Synonyms: | Propanol, (1-methyl-1,2-ethanediyl)bis(oxy)bis-, polymer with 1,1-methylenebisisocyanatobenzene and oxybispropanol;Polyurethane prepolymer of MDI and polyether polyol |
| CAS: | 68092-58-0 |
| Molecular Formula: | C30H44N2O9 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H10N2O2.C9H20O4.C6H14O3/c18-10-16-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)17-11-19;1-9(13-7-3-5-11)8-12-6-2-4-10;7-3-1-5-9-6-2-4-8/h1-8H,9H2;9-11H,2-8H2,1H3;7-8H,1-6H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 156.5°C |
| Boiling Point: | 379.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 156.5°C |
| Safety Data |
| |
 |
