| Identification |
| Name: | stearic acid, compound with 2-amino-2-methylpropan-1-ol (1:1) |
| Synonyms: | Octadecanoic acid, compd. with 2-amino-2-methyl-1-propanol (1:1);2-Amino-2-methyl-1-propanol, stearate (salt);Stearic acid, 2-amino-2-methylpropanol salt;Stearic acid, compound with 2-amino-2-methylpropan-1-ol (1:1);octadecanoic acid - 2-amino-2-methylpropan-1-ol (1:1) |
| CAS: | 68133-58-4 |
| EINECS: | 268-690-8 |
| Molecular Formula: | C22H47NO3 |
| Molecular Weight: | 373.6135 |
| InChI: | InChI=1/C18H36O2.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2,5)3-6/h2-17H2,1H3,(H,19,20);6H,3,5H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data |
| |
 |
