Identification |
Name: | 2-Propenoic acid, 2-methyl-, 2-methylpropyl ester, polymer with ethenylbenzene and 2-ethylhexyl 2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, 2-methylpropyl ester, polymer with ethenylbenzene and 2-ethylhexyl 2-propenoate;2-Propenoic acid, 2-methyl-, 2-methylpropyl ester, polymer with ethenylbenzene and 2-ethylhexyl 2-propenoate Ethenylbenzene, 2-ethylhexyl propenoate, 2-methylpropyl 2-methyl-2-propenoate polymer;styrene/ 2-ethylhexyl acrylate/ isobutyl methacrylate |
CAS: | 68240-06-2 |
Molecular Formula: | C27H42O4 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C11H20O2.C8H14O2.C8H8/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-6(2)5-10-8(9)7(3)4;1-2-8-6-4-3-5-7-8/h6,10H,3-5,7-9H2,1-2H3;6H,3,5H2,1-2,4H3;2-7H,1H2 |
Molecular Structure: |
 |
Properties |
Safety Data |
|
 |