| Identification | |
| Name: | 9H-Carbazole,3,6-dibromo- |
| Synonyms: | Carbazole,3,6-dibromo- (6CI,7CI,8CI);3,6-Dibromo-9H-carbazole;NSC121206; |
| CAS: | 6825-20-3 |
| Molecular Formula: | C12H7Br2N |
| Molecular Weight: | 325 |
| InChI: | InChI=1/C12H7Br2N/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,15H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 231.4°C |
| Boiling Point: | 459°C at 760 mmHg |
| Density: | 1.93g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.796 |
| Appearance: | tan to light green powder |
| Specification: |
3,6-Dibromo-9H-carbazole , its CAS NO. is 6825-20-3, the synonyms are 3,6-Dibromocarbazole ; Carbazole, 3,6-dibromo- ; 9H-Carbazole, 3,6-dibromo- ; MolPort-001-789-370 ; NSC121206 ; CID274874 . |
| Flash Point: | 231.4°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
