| Identification | |
| Name: | N-(2-aminoethyl)ethane-1,2-diamine - 2-[(4-methylphenoxy)methyl]oxirane (1:1) |
| Synonyms: | AC1O5CIQ;Cresyl glycidyl ether diethylene triamine adduct;N'-(2-aminoethyl)ethane-1,2-diamine; 2-[(4-methylphenoxy)methyl]oxirane;1,2-Ethanediamine, N-(2-aminoethyl)-, reaction products with glycidyl p-tolyl ether;1,2-Ethanediamine, N1-(2-aminoethyl)-, reaction products with glycidyl p-tolyl ether;68411-70-1 |
| CAS: | 68411-70-1 |
| Molecular Formula: | C14H25N3O2 |
| Molecular Weight: | 267.3672 |
| InChI: | InChI=1/C10H12O2.C4H13N3/c1-8-2-4-9(5-3-8)11-6-10-7-12-10;5-1-3-7-4-2-6/h2-5,10H,6-7H2,1H3;7H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 104.3°C |
| Boiling Point: | 258°C at 760 mmHg |
| Flash Point: | 104.3°C |
| Safety Data | |
 |
|
