Identification |
Name: | 2-Propenoic acid, telomer with sodium hydrogen sulfite, sodium salt |
Synonyms: | 2-Propenoic acid, telomer with sodium hydrogen sulfite, sodium salt;2-PROPENOICACID,TELOMERWITHSODIUMHYDROGENSULPHITE,SODIUMSALT;2-Propenoic acid, telomer with sodium sulfite (1:1), sodium salt;Acrylic acid sodium hydrogen sulfite telomer sodium salt;Acrylic acid sodium salt polymer, sodium sulfonate terminated |
CAS: | 68479-09-4 |
Molecular Formula: | C3H5NaO5S |
Molecular Weight: | 176.12357 |
InChI: | InChI=1S/C3H4O2.Na.H2O3S/c1-2-3(4)5;;1-4(2)3/h2H,1H2,(H,4,5);;(H2,1,2,3)/q;+1;/p-1 |
Molecular Structure: |
|
Properties |
Flash Point: | 61.6°C |
Boiling Point: | 141°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 61.6°C |
Safety Data |
|
|