| Identification |
| Name: | Benzenediamine,ar,ar-diethyl-ar-methyl- |
| Synonyms: | Diethyltoluenediamine;ar,ar-Diethyl-ar-methylbenzenediamine;Diethylmethylbenzenediamine;DETDA |
| CAS: | 68479-98-1 |
| EINECS: | 270-877-4 |
| Molecular Formula: | C11H18N2 |
| Molecular Weight: | 178.28 |
| InChI: | InChI=1/C11H18N2/c1-4-8-6-7(3)10(12)11(13)9(8)5-2/h6H,4-5,12-13H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3082 |
| Density: | 1.022 |
| Refractive index: | 1.581 |
| Packinggroup: | III |
| Usage: | LONZACURE(R) DETDA 80 is an excellent and low cost chain extender for elastomeric polyurethanes (PU) and also a curing agent for epoxides (EP). In addition it may be used as an intermediate for organic syntheses. WWW Link |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
