| Identification | |
| Name: | Propanedioic acid,2-bromo-, 1,3-diethyl ester |
| Synonyms: | Malonicacid, bromo-, diethyl ester (6CI,7CI,8CI);Propanedioic acid, bromo-, diethylester (9CI);2-Bromomalonic acid diethyl ester;Bromomalonic acid diethylester;Diethyl 2-bromo-1,3-propanedioate;Diethyl 2-bromomalonate;Diethyl2-bromopropanedioate;Diethyl bromomalonate;Diethyl a-bromomalonate;Ethylbromomalonate;NSC 1985;a-Bromomalonic ester; |
| CAS: | 685-87-0 |
| EINECS: | 211-683-1 |
| Molecular Formula: | C7H11BrO4 |
| Molecular Weight: | 239.06 |
| InChI: | InChI=1/C7H11BrO4/c1-3-11-6(9)5(8)7(10)12-4-2/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.402 |
| Refractive index: | 1.451 |
| Appearance: | clear colorless to slightly yellow liquid. |
| Specification: |
Diethyl bromomalonate (CAS NO.685-87-0) is also named as AI3-01376 ; Bromomalonic acid diethyl ester ; Diethyl 2-bromomalonate ; Ethyl bromomalonate ; Malonic acid, bromo-, diethyl ester ; NSC 1985 ; alpha-Bromomalonic ester ; Propanedioic acid, 2-bromo-, 1,3-diethyl ester ; Propanedioic acid, bromo-, diethyl ester . Diethyl bromomalonate (CAS NO.685-87-0) is clear colourless to slightly yellow liquid. |
| Packinggroup: | III |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
