| Identification | |
| Name: | Diethyl fluoromalonate |
| Synonyms: | Malonicacid, fluoro-, diethyl ester (6CI,7CI,8CI);Propanedioic acid, fluoro-, diethylester (9CI);Diethyl 2-fluoromalonate; |
| CAS: | 685-88-1 |
| EINECS: | 211-684-7 |
| Molecular Formula: | C7H11FO4 |
| Molecular Weight: | 178.16 |
| InChI: | InChI=1/C7H11FO4/c1-3-11-6(9)5(8)7(10)12-4-2/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.129 |
| Refractive index: | 1.407 |
| Appearance: | Clear colourless to pale yellow liquid |
| Specification: |
Diethyl fluoromalonate , its CAS NO. is 685-88-1, the synonyms are Diethyl fluoropropanedioate ; Fluoromalonic acid diethyl ester ; Malonic acid, fluoro-, diethyl ester ; Propanedioic acid, fluoro-, diethyl ester (9CI) . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
