| Identification |
| Name: | 1,2-Benzenedicarboxylic acid, benzyl C7-9-branched and linear alkyl esters |
| Synonyms: | Benzyl C7-9-branched and linear alkyl phthalates;Phthalic acid, benzyl alkyl(C7-C8) ester;benzyl octyl benzene-1,2-dicarboxylate |
| CAS: | 68515-40-2 |
| EINECS: | 271-082-5 |
| Molecular Formula: | C23H28O4 |
| Molecular Weight: | 368.466 |
| InChI: | InChI=1/C23H28O4/c1-2-3-4-5-6-12-17-26-22(24)20-15-10-11-16-21(20)23(25)27-18-19-13-8-7-9-14-19/h7-11,13-16H,2-6,12,17-18H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 222.6°C |
| Boiling Point: | 461°C at 760 mmHg |
| Density: | 1.079g/cm3 |
| Refractive index: | 1.537 |
| Flash Point: | 222.6°C |
| Safety Data |
| |
 |