| Identification |
| Name: | 2,5-Furandione, dihydro-3-(tetrapropenyl)-, reaction products with isopropanolamine |
| Synonyms: | Condensate of tetrapropenyl succinic anhydride and isopropanolamine;Tetrapropenyl succinic anhydride and isopropanolamine condensate;2,5-Furandione, dihydro-3-(tetrapropenyl)-, reaction products withisopropanolamine;3-[(1Z)-dodec-1-en-1-yl]dihydrofuran-2,5-dione - 1-aminopropan-2-ol (1:1) |
| CAS: | 68515-72-0 |
| EINECS: | 271-104-3 |
| Molecular Formula: | C19H35NO4 |
| Molecular Weight: | 341.4855 |
| InChI: | InChI=1/C16H26O3.C3H9NO/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18;1-3(5)2-4/h11-12,14H,2-10,13H2,1H3;3,5H,2,4H2,1H3/b12-11-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 173.6°C |
| Boiling Point: | 386.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 173.6°C |
| Safety Data |
| |
 |
