| Identification | |
| Name: | Hexanedioic acid, polymer with 1,2-propanediol, esters with C12-20-fatty acids |
| Synonyms: | Hexanedioic acid, polymer with 1,2-propanediol, esters with C12-20-fatty acids;POLYMER WITH 1,2-PROPANEDIOL, C12-20 FATTY ACID ESTERS;adipic acid/ propylene glycol, C12-20 fatty acid esters;Hexanedioic acid, polymer with 1,2-propanediol, esters with C12-2o-fatty acids;Propylene glycol, adipic acid polyester, terminated with (C12-C20)saturated and unsaturated momobasic fatty acids |
| CAS: | 68583-87-9 |
| Molecular Formula: | C9H18O6 |
| Molecular Weight: | 222.23562 |
| InChI: | InChI=1S/C6H10O4.C3H8O2/c7-5(8)3-1-2-4-6(9)10;1-3(5)2-4/h1-4H2,(H,7,8)(H,9,10);3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Safety Data | |
 |
|
