| Identification |
| Name: | Carbamodithioic acid,N,N-diethyl-, methyl ester |
| Synonyms: | Carbamic acid,diethyldithio-, methyl ester (6CI,7CI,8CI); Carbamodithioic acid, diethyl-,methyl ester (9CI); Diethyldithiocarbamate methyl ester; MethylN,N-diethyldithiocarbamate; Methyl diethyldithiocarbamate; NSC 133269 |
| CAS: | 686-07-7 |
| Molecular Formula: | C6H13 N S2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H13NS2/c1-4-7(5-2)6(8)9-3/h4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 79.9°C |
| Boiling Point: | 208.5°C at 760 mmHg |
| Density: | 1.061g/cm3 |
| Refractive index: | 1.548 |
| Specification: | Light Yellow Oil usageEng:A metabolite of a mixed disulfide S-(N,N-diethyldithiocarbamoyl)-N-acetyl-L-cysteine (AC-DDTC), an antimutagenic mixed disulfide from disulfiram. |
| Flash Point: | 79.9°C |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of a mixed disulfide S-(N,N-diethyldithiocarbamoyl)-N-acetyl-L-cysteine (AC-DDTC), an antimutagenic mixed disulfide from disulfiram. |
| Safety Data |
| |
 |