| Identification |
| Name: | 9-Octadecenoic acid (Z)-, epoxidized, ester with propylene glycol |
| Synonyms: | 9-Octadecenoic acid (Z)-, epoxidized, ester with propylene glycol;9-OCTADECANOICACID(Z)-,EPOXIDIZED,ESTERWITHPROPYLENEGLYCOL;EPOXIDIZEDPROPYLENEGLYCOLDIOLEATE;Propyleneglycol, epoxidized;propylene glycol dioleate, epoxidised;Octadecenoic acid (9Z)-, epoxidized, ester with propylene glycol |
| CAS: | 68609-92-7 |
| EINECS: | 271-842-6 |
| Molecular Formula: | C18H34O2 |
| Molecular Weight: | 282.46136 |
| InChI: | InChI=1/C18H34O2.C3H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3(5)2-4/h9-10H,2-8,11-17H2,1H3,(H,19,20);3-5H,2H2,1H3/b10-9-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 270.1°C |
| Safety Data |
| |
 |
