| Identification | |
| Name: | 2-Methylindoline |
| Synonyms: | 2,3-DIHYDRO-2-METHYLINDOLE; 2-methyl-1H-indole; 2-Methyl-2,3-dihydro-1H-indole |
| CAS: | 6872-06-6 |
| EINECS: | 229-971-0 |
| Molecular Formula: | C9H11N |
| Molecular Weight: | 133.19 |
| InChI: | InChI=1/C9H11N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-5,7,10H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.02 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.568-1.57 |
| Water Solubility: | negligible |
| Solubility: | negligible |
| Appearance: | clear to yellow liquid |
| Specification: |
?2-Methylindoline , its CAS NO. is 6872-06-6, the synonyms are R,S)-2-Methyl-2,3-dihydro-1H-indole ; 1H-Indole, 2,3-dihydro-2-methyl- ; 1H-Indole,2,3-dihydro-2-methyl- ; 2,3-dihydro-2-methyl-1h-indol ; 2,3-Dihydro-2-methyl-1H-indole ; 2-Methyl-2,3-dihydroindole ; 2-methyl-indolin ; alpha-Methyldihydroindole?. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
