| Identification | |
| Name: | Benzeneacetic acid, a-methyl-4-[(2-oxocyclopentyl)methyl]- |
| Synonyms: | 2-[4-[(2-Oxocyclopentan-1-yl)methyl]phenyl]propionicacid;2-[4-[(2-Oxocyclopentyl)methyl]phenyl]propionic acid;(+-)-p-((2-Oxocyclopentyl)methyl)hydratropic acid; |
| CAS: | 68767-14-6 |
| Molecular Formula: | C15H18O3 |
| Molecular Weight: | 246.30162 |
| InChI: | InChI=1S/C15H18O3/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16/h5-8,10,13H,2-4,9H2,1H3,(H,17,18) |
| Molecular Structure: | ![(C15H18O3) 2-[4-[(2-Oxocyclopentan-1-yl)methyl]phenyl]propionicacid;2-[4-[(2-Oxocyclopentyl)methyl]phenyl]propi...](https://img.guidechem.com/casimg/68767-14-6.gif) |
| Properties | |
| Transport: | HAZARD |
| Melting Point: | 108.5 - 111 |
| Flash Point: | 220 |
| Boiling Point: | 418 |
| Density: | 1.18 g/cm3 (20 C) |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.567 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | White to yellowish crystalline powder |
| Flash Point: | 220 |
| Storage Temperature: | Keep container tightly closed. |
| Usage: | Anti-inflammatory; analgesic. |
| Safety Data | |
| Hazard Symbols |
6.1 (Packing Group: I) UN NO.
|
 |
|
