| Identification | |
| Name: | 2-Propenoic acid,1-methylethyl ester |
| Synonyms: | Acrylicacid, isopropyl ester (6CI,8CI); Isopropyl 2-propenoate; Isopropyl acrylate;NSC 32619 |
| CAS: | 689-12-3 |
| EINECS: | 211-710-7 |
| Molecular Formula: | C6H10 O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c1-4-6(7)8-5(2)3/h4-5H,1H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Flash Point: | 22.9°C |
| Boiling Point: | 51-52°C 103mm |
| Density: | 0,893 g/cm3 |
| Refractive index: | 1.409 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Flash Point: | 22.9°C |
| Safety Data | |
 |
|
