| Identification | |
| Name: | N-(3,3-DIPHENYLPROPYL)-α-METHYL-PHENETHYLAMINE LACTATE |
| Synonyms: | agozol;angormin;coredamin;corontin;crepasin;incoran;irrorin;n-(3,3-diphenylpropyl)-alpha-methylphenethylaminelactate |
| CAS: | 69-43-2 |
| EINECS: | 200-705-5 |
| Molecular Formula: | C24H27N . C3H6O3 |
| Molecular Weight: | 419.61 |
| InChI: | InChI=1/C5H11N.C3H6O3/c1-5(2)3-4-6;1-2(4)3(5)6/h3H,4,6H2,1-2H3;2,4H,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 159.5°C |
| Boiling Point: | 340.2°C at 760 mmHg |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 159.5°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
