| Identification | |
| Name: | 4-(N,N-Dibutylamino)pyridine |
| Synonyms: | N,N-dibutylpyridin-4-amine;4-pyridinamine, N,N-dibutyl-;N,N-Dibutyl-4-pyridinamine; |
| CAS: | 69008-71-5 |
| Molecular Formula: | C13H22N2 |
| Molecular Weight: | 206.33 |
| InChI: | InChI=1/C13H22N2/c1-3-5-11-15(12-6-4-2)13-7-9-14-10-8-13/h7-10H,3-6,11-12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.939 g/cm3 |
| Refractive index: | 1.516 |
| Specification: |
The 4-(N,N-Dibutylamino)pyridine with the cas number 69008-71-5 is also called N,N-dibutylpyridin-4-amine .The 4-(N,N-Dibutylamino)pyridine can be supplied by the following suppliers: (1)Hangzhou Disynthesis Chemical Technology Co., Ltd. ; (2)Specs ; (3)Aurora Fine Chemicals LLC. The properties of 4-(N,N-Dibutylamino)pyridine are: (1)#H bond acceptors: 2 ; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 7; (4)Polar Surface Area: 16.13 Å2; (5)Index of Refraction: 1.516; (6)Molar Refractivity: 66.45 cm3; (7)Molar Volume: 219.6 cm3; (8)Polarizability: 26.34×10-24cm3; (9)Surface Tension: 37 dyne/cm ; (10)Enthalpy of Vaporization: 54.5 kJ/mol; (11)Vapour Pressure: 0.000864 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
