| Identification | |
| Name: | 1,5-Dioxaspiro[5.5]undecan-9-one,3,3-dimethyl- |
| Synonyms: | 1,4-Cyclohexanedionemono(2,2-dimethyltrimethylene ketal);1,4-Cyclohexanedione mono-2,2-dimethyltrimethylene ketal; |
| CAS: | 69225-59-8 |
| EINECS: | 273-918-4 |
| Molecular Formula: | C11H18O3 |
| Molecular Weight: | 198.26 |
| InChI: | InChI=1/C11H18O3/c1-10(2)7-13-11(14-8-10)5-3-9(12)4-6-11/h3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 295.4°C at 760 mmHg |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.484 |
| Appearance: | White to yellowish powder |
| Specification: |
1,5-Dioxaspiro[5.5]undecan-9-one,3,3-dimethyl- , its cas register number is 69225-59-8. It also can be called 3,3-Dimethyl-1,5-dioxaspiro(5.5)undecan-9-one ; 1,4-Cyclohexanedione Mono(2,2-dimethyltrimethylene Ketal) . 1,5-Dioxaspiro[5.5]undecan-9-one,3,3-dimethyl- (CAS NO.69225-59-8) is irritating to eyes, respiratory system and skin. |
| Safety Data | |
 |
|
