| Identification | |
| Name: | 2-(diethylamino)ethyl 2-(propylsulfanyl)pentanoate hydrochloride |
| Synonyms: | 2-Propylthiovaleric acid O-ester with 2-(diethylamino)ethanol hydrochloride;Dipropylthioacetate de O-diethylaminoethyle [French];Valeric acid, 2-propylthio-, O-ester with 2-(diethylamino)ethanol, hydrochloride;AC1MHJW9;Dipropylthioacetate de O-diethylaminoethyle;LS-161175;2-diethylaminoethyl 2-propylsulfanylpentanoate hydrochloride;69226-67-1 |
| CAS: | 69226-67-1 |
| Molecular Formula: | C14H30ClNO2S |
| Molecular Weight: | 311.9115 |
| InChI: | InChI=1/C14H29NO2S.ClH/c1-5-9-13(18-12-6-2)14(16)17-11-10-15(7-3)8-4;/h13H,5-12H2,1-4H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.5°C |
| Boiling Point: | 355.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 168.5°C |
| Safety Data | |
 |
|
