| Identification | |
| Name: | 2-Octanamine |
| Synonyms: | 1-Methylheptylamine;Octan-2-amin; |
| CAS: | 693-16-3 |
| EINECS: | 211-744-2 |
| Molecular Formula: | C8H19N |
| Molecular Weight: | 129.24 |
| InChI: | InChI=1/C8H19N/c1-3-4-5-6-7-8(2)9/h8H,3-7,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 8/PG 2 |
| Density: | 0.771 |
| Refractive index: | n20/D 1.4235(lit.) |
| Appearance: | clear colourless to slightly yellow liquid |
| Specification: |
The extinguishing agent of 2-Aminooctane (CAS No. 693-16-3) are dry powder, foam, sand, carbon dioxide, water mist. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
