| Identification |
| Name: | 2,4-Oxazolidinedione,5,5-dimethyl- |
| Synonyms: | AC 1198;5,5-Dimethyloxazolidinedione;5,5-Dimethyl-2,4-oxazolidinedione;5,5-Dimethyl-1,3-oxazolidine-2,4-dione;Nortrimethadione;NSC 30152;Dimethadion;DMO;BAY 1400Z;BAX1400Z;Eupractone; |
| CAS: | 695-53-4 |
| EINECS: | 211-781-4 |
| Molecular Formula: | C5H7NO3 |
| Molecular Weight: | 129.11 |
| InChI: | InChI=1/C5H7NO3/c1-5(2)3(7)6-4(8)9-5/h1-2H3,(H,6,7,8) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 44.2°C |
| Boiling Point: | 137 °C / 6mmHg |
| Density: | 1.243g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.464 |
| Solubility: | Very soluble |
| Appearance: | Colorless solid. |
| Flash Point: | 44.2°C |
| Storage Temperature: | 2-8°C |
| Usage: | Substance is used in vivo measurement of intracellular ph. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
