| Identification |
| Name: | 2-Bromo-4-chlorophenol |
| Synonyms: | 2-Bromo-4-chlorophenol;NSC 59695 |
| CAS: | 695-96-5 |
| EINECS: | 211-785-6 |
| Molecular Formula: | C6H4BrClO |
| Molecular Weight: | 207.45 |
| InChI: | InChI=1/C6H4BrClO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2020 6 |
| Density: | 1.788 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.619 |
| Water Solubility: | methanol: 0.1 g/mL, clear |
| Solubility: | methanol: 0.1 g/mL, clear |
| Appearance: | White to slightly beige low melting solid |
| Packinggroup: | I; II; III |
| HS Code: | 29081000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
