| Identification | |
| Name: | Ethyl N-(diphenylmethylene)glycinate |
| Synonyms: | Glycine,N-(diphenylmethylene)-, ethyl ester;(Benzhydrylideneamino)aceticacid ethyl ester;Ethyl (benzhydrylideneamino)acetate;N-(Diphenylmethylene)glycine ethyl ester;NSC 263808;ethyl 2-(diphenylmethyleneamino)acetate;Diphenylmethylene-Glycine Ethyl ester; |
| CAS: | 69555-14-2 |
| Molecular Formula: | C17H17NO2 |
| Molecular Weight: | 267.32 |
| InChI: | InChI=1/C17H17NO2/c1-2-20-16(19)13-18-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.04 g/cm3 |
| Refractive index: | 1.542 |
| Appearance: | white to light yellow crystalline powder |
| Specification: |
Ethyl N-(diphenylmethylene)glycinate , its cas register number is 69555-14-2. It also can be called N-(Diphenylmethylene)glycine ethyl ester .It is a white to light yellow crystalline powder. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
