| Identification | |
| Name: | Ethanol,2-[(4-aminopentyl)ethylamino]- |
| Synonyms: | N-Ethyl-N-(2-hydroxyethyl)-4-aminopentylamine; |
| CAS: | 69559-11-1 |
| EINECS: | 274-039-9 |
| Molecular Formula: | C9H22N2O |
| Molecular Weight: | 174.29 |
| InChI: | InChI=1/C9H22N2O/c1-3-11(7-8-12)6-4-5-9(2)10/h9,12H,3-8,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 113.2 ºC |
| Boiling Point: | 263.6 ºC at 760 mmHg |
| Density: | 0.935 |
| Refractive index: | 1.470-1474 |
| Specification: |
Ethanol,2-[(4-aminopentyl)ethylamino]- , its cas register number 69559-11-1. It also can be called 5-(N-Ethyl-N-2-hydroxyethylamino)-2-penthlamine ; and 2-(4-Aminopentyl(ethyl)amino)ethanol . |
| Flash Point: | 113.2 ºC |
| Safety Data | |
 |
|
