| Identification | |
| Name: | 2-Methyl-4-nitroimidazole |
| Synonyms: | 1H-Imidazole,2-methyl-4-nitro- (9CI);Imidazole, 2-methyl-4(or 5)-nitro- (7CI);Imidazole,2-methyl-4-nitro- (8CI);2-Methyl-4-nitro-1H-imidazole;2-Methyl-5-nitro-1H-imidazole;2-Methyl-5-nitroimidazole;L 581490;RP 8532;1H-Imidazole,2-methyl-5-nitro-; |
| CAS: | 696-23-1 |
| EINECS: | 211-790-3 |
| Molecular Formula: | C4H5N3O2 |
| Molecular Weight: | 127.1014 |
| InChI: | InChI=1S/C4H5N3O2/c1-3-5-2-4(6-3)7(8)9/h2H,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 251-255 °C(lit.) |
| Flash Point: | 195.4°C |
| Boiling Point: | 399.5°C at 760 mmHg |
| Density: | 1.426g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.591 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Toxicity data |
| Solubility: |
|
| Appearance: | solid |
| Specification: | solid usageEng:Floconazole impurity. Safety Statements:36/37 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 195.4°C |
| Storage Temperature: | Refrigerator |
| Usage: | Floconazole impurity. |
| Safety Data | |
 |
|
