| Identification | |
| Name: | 1-Iodo-4-methoxybenzene |
| Synonyms: | Anisole,4-iodo- (6CI);Anisole, p-iodo- (7CI,8CI);4-Iodomethoxybenzene;4-Iodophenyl methyl ether;4-Methoxy-1-iodobenzene;4-Methoxyiodobenzene;4-Methoxyphenyl iodide;Isoform;NSC 60727;p-Iodoanisole;p-Iodomethoxybenzene;p-Iodophenyl methyl ether;p-Methoxyiodobenzene;p-Methoxyphenyl iodide; |
| CAS: | 696-62-8 |
| EINECS: | 211-798-7 |
| Molecular Formula: | C7H7IO |
| Molecular Weight: | 234.04 |
| InChI: | InChI=1/C7H7IO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 95.1oC |
| Density: | 1.727 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Light sensitive. |
| Refractive index: | 1.591 |
| Solubility: | Insoluble |
| Appearance: | Yellow to brown powder. |
| HS Code: | 29093090 |
| Flash Point: | 95.1oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
