| Identification |
| Name: | 2,3,5-Trimethylphenol |
| Synonyms: | Isopseudocumenol; 2,3,5-Trimethylphenol/TMP/Isopseudocumenol; 2,3,5-Thrimethylphenol; Di-methyl aminobenzene |
| CAS: | 697-82-5 |
| EINECS: | 211-806-9 |
| Molecular Formula: | C9H12O |
| Molecular Weight: | 136.19 |
| InChI: | InChI=1/C9H12O/c1-6-4-7(2)8(3)9(10)5-6/h4-5,10H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2430 |
| Density: | 0.996g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.535 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | White to off-white powder |
| Packinggroup: | III |
| HS Code: | 29071900 |
| Storage Temperature: | Store in dark! |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
